![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| #H0-LiveSteam/ | 2019-11-07 10:07 | - | |
| 6 x 4 bandsaw mod/ | 2019-11-07 10:07 | - | |
| 7x10 - 4 Jaw chuck/ | 2019-11-07 10:07 | - | |
| 9X20 CENTER PUNCH JIG/ | 2019-11-07 10:07 | - | |
| 9X20 DIAL INDICATOR HOLDER/ | 2019-11-07 10:07 | - | |
| 9X20 LEADSCREW HANDWHEEL/ | 2019-11-07 10:07 | - | |
| 9x20/ | 2019-11-07 10:08 | - | |
| 9x20 DRO/ | 2019-11-07 10:07 | - | |
| 9x20 Electronic Variable Speed/ | 2019-11-07 10:07 | - | |
| 9x20 Lathe/ | 2019-11-07 10:07 | - | |
| 9x20 Milling Attachment/ | 2019-11-07 10:07 | - | |
| 9x20 Motor/ | 2019-11-07 10:08 | - | |
| 9x20 Variable Speed with Jackshaft/ | 2019-11-07 10:08 | - | |
| 9x20 variable speed model/ | 2019-11-07 10:08 | - | |
| 10x24/ | 2019-11-07 10:07 | - | |
| 38 vapeur/ | 2019-11-07 10:07 | - | |
| AEL's/ | 2019-11-07 10:08 | - | |
| AJ's Pics/ | 2019-11-07 10:08 | - | |
| AMA250AV-F/ | 2019-11-07 10:08 | - | |
| A Panaceabeachbum/ | 2019-11-07 10:08 | - | |
| ARTEK PHOTOS/ | 2019-11-07 10:08 | - | |
| AXA QCTP on 9x20 lathe/ | 2019-11-07 10:08 | - | |
| Aaron's Photos/ | 2019-11-07 10:08 | - | |
| Accessories/ | 2019-11-07 10:08 | - | |
| Adam';s Projects/ | 2019-11-07 10:08 | - | |
| Akraven's album/ | 2019-11-07 10:08 | - | |
| Andres Dans/ | 2019-11-07 10:08 | - | |
| Andys 2nd hand 920/ | 2019-11-07 10:08 | - | |
| Anyi World Precision Measuring Tools/ | 2019-11-07 10:08 | - | |
| Arjay';s projects/ | 2019-11-07 10:08 | - | |
| Arjays simple ball turner/ | 2019-11-07 10:08 | - | |
| Art9999';s Photos/ | 2019-11-07 10:08 | - | |
| BZ';s Pics/ | 2019-11-07 10:08 | - | |
| Back Plate Turning Question/ | 2019-11-07 10:08 | - | |
| Bad Threading/ | 2019-11-07 10:08 | - | |
| Bamban/ | 2019-11-07 10:08 | - | |
| Bearing Replacement/ | 2019-11-07 10:08 | - | |
| Belt Tension Fix/ | 2019-11-07 10:08 | - | |
| Benches for 9x20 Lathes/ | 2019-11-07 10:08 | - | |
| Bill S/ | 2019-11-07 10:08 | - | |
| Bills Shop/ | 2019-11-07 10:08 | - | |
| Bob's stuff (deere_x475guy)/ | 2019-11-07 10:08 | - | |
| Broken Bits/ | 2019-11-07 10:08 | - | |
| Broken Gears/ | 2019-11-07 10:08 | - | |
| CBA's QCTP modified for a 9X20/ | 2019-11-07 10:08 | - | |
| CT-918/ | 2019-11-07 10:08 | - | |
| CT-918 Lathe/ | 2019-11-07 10:08 | - | |
| Carriage Lock Improvement/ | 2019-11-07 10:08 | - | |
| Carriage Lock from a Seat Post Clamp/ | 2019-11-07 10:08 | - | |
| Carriage Plates/ | 2019-11-07 10:08 | - | |
| ChangeGearBushes/ | 2019-11-07 10:08 | - | |
| Charles Projects/ | 2019-11-07 10:08 | - | |
| Chip Shield - Adjustable/ | 2019-11-07 10:08 | - | |
| Chippie's stuff/ | 2019-11-07 10:08 | - | |
| Chris/ | 2019-11-07 10:08 | - | |
| Chucks/ | 2019-11-07 10:08 | - | |
| Cletus' Grizzly G4000 CBX DRO/ | 2019-11-07 10:08 | - | |
| Clutch mod/ | 2019-11-07 10:08 | - | |
| Clutch pulley mod/ | 2019-11-07 10:08 | - | |
| Collet Holder/ | 2019-11-07 10:08 | - | |
| Conrad's Lathe mods/ | 2019-11-07 10:08 | - | |
| Conrad's Models/ | 2019-11-07 10:08 | - | |
| Cross Slide Leadscrew/ | 2019-11-07 10:08 | - | |
| Cross Slide Wobble/ | 2019-11-07 10:08 | - | |
| Crosspein's Photos/ | 2019-11-07 10:08 | - | |
| DRO/ | 2019-11-07 10:08 | - | |
| DRP shops/ | 2019-11-07 10:09 | - | |
| Daddyo217's Stuff/ | 2019-11-07 10:08 | - | |
| David Williams 9X20 lathe WholeSale/ | 2019-11-07 10:08 | - | |
| David_Steele59/ | 2019-11-07 10:08 | - | |
| Delcano/ | 2019-11-07 10:08 | - | |
| Den/ | 2019-11-07 10:08 | - | |
| Denis's Stuff/ | 2019-11-07 10:08 | - | |
| DogClutch/ | 2019-11-07 10:08 | - | |
| Drawers/ | 2019-11-07 10:08 | - | |
| ELS photos/ | 2019-11-07 10:09 | - | |
| Enco 9x20/ | 2019-11-07 10:09 | - | |
| Enco Belt Problem/ | 2019-11-07 10:09 | - | |
| Enco Lathe Gear Replacement/ | 2019-11-07 10:09 | - | |
| Erics Uploads/ | 2019-11-07 10:09 | - | |
| Ernie's Stuff/ | 2019-11-07 10:09 | - | |
| Eyeball's tool post/ | 2019-11-07 10:09 | - | |
| FIXIT'S STUFF/ | 2019-11-07 10:09 | - | |
| Faucet Handles/ | 2019-11-07 10:09 | - | |
| Feed/ | 2019-11-07 10:00 | - | |
| Fixture Details/ | 2019-11-07 10:09 | - | |
| Frejoth F-450/ | 2019-11-07 10:09 | - | |
| Frsaren/ | 2019-11-07 10:09 | - | |
| G4000 modifications by Dan Mardis/ | 2019-11-07 10:09 | - | |
| Gary's Stuff/ | 2019-11-07 10:09 | - | |
| Gear end support/ | 2019-11-07 10:09 | - | |
| Gerhard's Mods/ | 2019-11-07 10:09 | - | |
| Gimor's Goodies/ | 2019-11-07 10:09 | - | |
| Grinding Table/ | 2019-11-07 10:09 | - | |
| Grizzly0516/ | 2019-11-07 10:09 | - | |
| Grizzly P4000737 - GEAR SHAFT 18T/ | 2019-11-07 10:09 | - | |
| Guy's Shop/ | 2019-11-07 10:09 | - | |
| HF 45861 built 06 2009/ | 2019-11-07 10:09 | - | |
| HF Mini Lathe Quick Change Tool Post Set/ | 2019-11-07 10:09 | - | |
| Halfnutz Shop/ | 2019-11-07 10:09 | - | |
| Hand Crank From Bicycle Parts/ | 2019-11-07 10:09 | - | |
| Harbor Freight 9x20 Switch/ | 2019-11-07 10:09 | - | |
| He said it was a 9x20/ | 2019-11-07 10:09 | - | |
| Hilmar/ | 2019-11-07 10:09 | - | |
| Hold on a bit for me/ | 2019-11-07 10:09 | - | |
| Ivan's/ | 2019-11-07 10:09 | - | |
| JET BD-920N Thread Dial Problem/ | 2019-11-07 10:09 | - | |
| Jacks Stuff/ | 2019-11-07 10:09 | - | |
| Jensen/ | 2019-11-07 10:09 | - | |
| Jim';s Big 6-Inch ... 4-Jaw Chuck/ | 2019-11-07 10:09 | - | |
| Jim's Place/ | 2019-11-07 10:09 | - | |
| Jim's Shed/ | 2019-11-07 10:09 | - | |
| Jim E.';s 9x20 DROs - Crosslide #2/ | 2019-11-07 10:09 | - | |
| Jim E.';s Photos - General/ | 2019-11-07 10:09 | - | |
| Jim E.';s Strobe Patterns/ | 2019-11-07 10:09 | - | |
| Jim E.'s 9x20 - Mounting Bolt/ | 2019-11-07 10:09 | - | |
| Jim E.'s 9x20 DROs - Compound/ | 2019-11-07 10:09 | - | |
| Jim E.'s 9x20 DROs - Crosslide/ | 2019-11-07 10:09 | - | |
| Jim E.'s Photos/ | 2019-11-07 10:00 | - | |
| John Baxter/ | 2019-11-07 10:09 | - | |
| Johns stop mod/ | 2019-11-07 10:09 | - | |
| Jughed Mods/ | 2019-11-07 10:09 | - | |
| Justabajabum's Stuff/ | 2019-11-07 10:09 | - | |
| K4KJF/ | 2019-11-07 10:09 | - | |
| Keith';s photos/ | 2019-11-07 10:09 | - | |
| Kelly's Lathe/ | 2019-11-07 10:09 | - | |
| Ken Hunter/ | 2019-11-07 10:09 | - | |
| KenPhotos/ | 2019-11-07 10:09 | - | |
| Kenlambert/ | 2019-11-07 10:09 | - | |
| Kirk/ | 2019-11-07 10:09 | - | |
| Kmot';s Harbor Freight 9x20 Lathe/ | 2019-11-07 10:09 | - | |
| Knurling Tool/ | 2019-11-07 10:09 | - | |
| Knutsen's Mods/ | 2019-11-07 10:09 | - | |
| Larry's stuff/ | 2019-11-07 10:09 | - | |
| Lathe/ | 2019-11-07 10:09 | - | |
| Lathe Bench/ | 2019-11-07 10:09 | - | |
| Lathe Bench and Cabinet/ | 2019-11-07 10:09 | - | |
| Lathemaster 9x20/ | 2019-11-07 10:09 | - | |
| Lathe stand mod/ | 2019-11-07 10:09 | - | |
| Lathe with mill head (G0516)/ | 2019-11-07 10:09 | - | |
| Leadscrew Handle/ | 2019-11-07 10:09 | - | |
| Lena the Lathe/ | 2019-11-07 10:09 | - | |
| LimeyLew's Lathe/ | 2019-11-07 10:09 | - | |
| Long Lead Threads/ | 2019-11-07 10:09 | - | |
| Lykle';s photo';s/ | 2019-11-07 10:09 | - | |
| Mac's Pictures/ | 2019-11-07 10:09 | - | |
| MachTach Tachometer/ | 2019-11-07 10:09 | - | |
| Mark's stuff/ | 2019-11-07 10:09 | - | |
| Marv's folder/ | 2019-11-07 10:09 | - | |
| Matthews 10x30/ | 2019-11-07 10:09 | - | |
| Method of Setting Compound Angle/ | 2019-11-07 10:09 | - | |
| Mill Spindle Locking/ | 2019-11-07 10:00 | - | |
| Miscellaneous/ | 2019-11-07 10:09 | - | |
| Mitchard's makings/ | 2019-11-07 10:09 | - | |
| My 9 x 20/ | 2019-11-07 10:09 | - | |
| My Harborfreight 9 x 20 lathe/ | 2019-11-07 10:09 | - | |
| My Stuff/ | 2019-11-07 10:09 | - | |
| NXr';s Junk/ | 2019-11-07 10:09 | - | |
| Nats mods/ | 2019-11-07 10:09 | - | |
| Nseaguy2001/ | 2019-11-07 10:09 | - | |
| PTJeff';s first/ | 2019-11-07 10:09 | - | |
| PalePaul's Projects/ | 2019-11-07 10:09 | - | |
| Paul - Grind Lathe Tool Bits Cover Pahe/ | 2019-11-07 10:09 | - | |
| Pete';s Lathe, early days/ | 2019-11-07 10:09 | - | |
| Peter Sanders/ | 2019-11-07 10:09 | - | |
| Phase II Adapter/ | 2019-11-07 10:09 | - | |
| Phil's Engine Work/ | 2019-11-07 10:09 | - | |
| Phil B's Stuff/ | 2019-11-07 10:09 | - | |
| Pictures of my newly painted EMCO 8/ | 2019-11-07 10:09 | - | |
| Pitkin/ | 2019-11-07 10:09 | - | |
| Polishing Tumbler/ | 2019-11-07 10:09 | - | |
| Prasad - Wynnewood PA/ | 2019-11-07 10:09 | - | |
| QCTP homemade/ | 2019-11-07 10:10 | - | |
| RCSchink/ | 2019-11-07 10:10 | - | |
| RayL's Stuff/ | 2019-11-07 10:10 | - | |
| Raymond/ | 2019-11-07 10:10 | - | |
| Rays Photos/ | 2019-11-07 10:10 | - | |
| Reid chuck/ | 2019-11-07 10:10 | - | |
| Reverse Tumbler/ | 2019-11-07 10:10 | - | |
| RichK's stuff/ | 2019-11-07 10:10 | - | |
| Rick Hoo Hoo/ | 2019-11-07 10:10 | - | |
| Ronpat/ | 2019-11-07 10:10 | - | |
| Rotary Table Arbor to adapt 9X Chucks/ | 2019-11-07 10:10 | - | |
| Round QCTP/ | 2019-11-07 10:10 | - | |
| SDR_Lathe/ | 2019-11-07 10:10 | - | |
| SIEMENS 440 VFD/ | 2019-11-07 10:10 | - | |
| Shaoxing Machine Tool Works BV920/ | 2019-11-07 10:10 | - | |
| Single_Phase_Wiring_Question/ | 2019-11-07 10:10 | - | |
| Small live center/ | 2019-11-07 10:10 | - | |
| Spindle Bearing Replacement - P6/ | 2019-11-07 10:10 | - | |
| Spindle Lock/ | 2019-11-07 10:10 | - | |
| Spindle wheel crank/ | 2019-11-07 10:10 | - | |
| Steve Bedair';s Ball Turner/ | 2019-11-07 10:10 | - | |
| StevenC/ | 2019-11-07 10:10 | - | |
| Stuff by Bob/ | 2019-11-07 10:10 | - | |
| Swarf tray/ | 2019-11-07 10:10 | - | |
| Tacho/ | 2019-11-07 10:10 | - | |
| TejasDragon/ | 2019-11-07 10:10 | - | |
| Therealstubots_pix/ | 2019-11-07 10:10 | - | |
| ThornDesign/ | 2019-11-07 10:10 | - | |
| Threading gear shaft mod/ | 2019-11-07 10:10 | - | |
| Tim's tap and die guide/ | 2019-11-07 10:10 | - | |
| Tim/ | 2019-11-07 10:10 | - | |
| Tintruder/ | 2019-11-07 10:10 | - | |
| Tintruders CNC Setup/ | 2019-11-07 10:10 | - | |
| Tintruders DRO Setup/ | 2019-11-07 10:10 | - | |
| Tony Fitzgerald/ | 2019-11-07 10:10 | - | |
| Tool Post and Chuck/ | 2019-11-07 10:10 | - | |
| Traditional F-N-R Lever/ | 2019-11-07 10:10 | - | |
| TreadmillMotor/ | 2019-11-07 10:10 | - | |
| Unknown tools/ | 2019-11-07 10:10 | - | |
| VFD Conversion/ | 2019-11-07 10:10 | - | |
| Vertical Slide/ | 2019-11-07 10:10 | - | |
| WT4Y Projects/ | 2019-11-07 10:10 | - | |
| Walter';s Shop and Projects/ | 2019-11-07 10:10 | - | |
| What Is This_/ | 2019-11-07 10:10 | - | |
| What a mill/ | 2019-11-07 10:10 | - | |
| What is it_/ | 2019-11-07 10:10 | - | |
| Worm Gear Support Improvement/ | 2019-11-07 10:10 | - | |
| Worm Gear by Ray Vivian/ | 2019-11-07 10:10 | - | |
| Wrenchs For Sale/ | 2019-11-07 10:10 | - | |
| _/ | 2019-11-07 10:07 | - | |
| _ 9X20 Deluxe Pulley Puller/ | 2019-11-07 10:07 | - | |
| _9X20 SHOP PRESS/ | 2019-11-07 10:07 | - | |
| _ 9x20 MODS/ | 2019-11-07 10:07 | - | |
| _C8SpindleBearing/ | 2019-11-07 10:07 | - | |
| _Denis';s Album/ | 2019-11-07 10:07 | - | |
| _InvertedParting/ | 2019-11-07 10:07 | - | |
| _Jackson_Compound/ | 2019-11-07 10:07 | - | |
| _ PUNCH HOLDER/ | 2019-11-07 10:07 | - | |
| __Spider/ | 2019-11-07 10:07 | - | |
| __Spyder_Simple/ | 2019-11-07 10:07 | - | |
| __Tailstock_Detail/ | 2019-11-07 10:07 | - | |
| ___Glanze/ | 2019-11-07 10:07 | - | |
| ___cba_SwivelChipGuard/ | 2019-11-07 10:07 | - | |
| alans mill/ | 2019-11-07 10:08 | - | |
| alpes francises/ | 2020-01-05 10:39 | - | |
| alpes franxises/ | 2020-01-05 15:56 | - | |
| bro_zak/ | 2019-11-07 10:08 | - | |
| chris1234b/ | 2019-11-07 10:08 | - | |
| dalee's Stuff/ | 2019-11-07 10:08 | - | |
| dial indicators/ | 2019-11-07 10:08 | - | |
| enco10x24/ | 2019-11-07 10:09 | - | |
| g4000 lathe mods ect/ | 2019-11-07 10:09 | - | |
| hanermos lathe/ | 2019-11-07 10:09 | - | |
| hannus-cnc hercules 3500/ | 2019-11-07 10:09 | - | |
| hman's stuff/ | 2019-11-07 10:09 | - | |
| hosinsky/ | 2019-11-07 10:09 | - | |
| javatodd/ | 2019-11-07 10:09 | - | |
| jlmanatee's pics/ | 2019-11-07 10:09 | - | |
| lamaneta/ | 2019-11-07 10:09 | - | |
| markpfanenstiel/ | 2019-11-07 10:09 | - | |
| mattinker/ | 2019-11-07 10:09 | - | |
| oshs photos/ | 2019-11-07 10:09 | - | |
| phil/ | 2019-11-07 10:09 | - | |
| phills 918/ | 2019-11-07 10:09 | - | |
| phils stuff/ | 2019-11-07 10:09 | - | |
| pitobread's Lathe Mods & Repairs/ | 2019-11-07 10:09 | - | |
| randyrls misc photos/ | 2019-11-07 10:10 | - | |
| rene's pictures/ | 2019-11-07 10:10 | - | |
| rods & indicator for carriage/ | 2019-11-07 10:10 | - | |
| sergi misc/ | 2019-11-07 10:10 | - | |
| slower spindle speed/ | 2019-11-07 10:10 | - | |
| work/ | 2019-11-07 10:10 | - | |
| xmorbiusx/ | 2019-11-07 10:10 | - | |