![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| BALL TOOLPOST_915949134.jpg | 2019-11-07 10:08 | 13K | |
| Big Chuck_2098450157.jpg | 2019-11-07 10:08 | 25K | |
| Closeup of the Tach Sensor_1957712742.jpg | 2019-11-07 10:08 | 17K | |
| Compound Mod_1076368842.jpg | 2019-11-07 10:08 | 21K | |
| Drawbar_350532587.jpg | 2019-11-07 10:08 | 30K | |
| G4000 With CBX DRO & Tach_1220210011.jpg | 2019-11-07 10:08 | 17K | |
| Grinding_752653125.jpg | 2019-11-07 10:08 | 26K | |
| Handwheel on lathe_91980635.jpg | 2019-11-07 10:08 | 18K | |
| QC Toolpost_556841329.jpg | 2019-11-07 10:08 | 22K | |
| Reverse Tumbler_700876551.jpg | 2019-11-07 10:08 | 20K | |
| Skinner Chuck_1430652446.jpg | 2019-11-07 10:08 | 23K | |
| TACH & DRO Mounting_1206890483.jpg | 2019-11-07 10:08 | 17K | |
| Worms_1520067878.jpg | 2019-11-07 10:08 | 22K | |
| X - Y Encoder Mounting_1275909186.jpg | 2019-11-07 10:08 | 18K | |
| Y Scale Installation_1775844302.jpg | 2019-11-07 10:08 | 19K | |
